1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-3-(tert-butylamino)propan-1-ol structure
|
Common Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-3-(tert-butylamino)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 59227-74-6 | Molecular Weight | 394.35500 | |
| Density | 1.287g/cm3 | Boiling Point | 427.8ºC at 760 mmHg | |
| Molecular Formula | C18H20F6N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-3-(tert-butylamino)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760 mmHg |
| Molecular Formula | C18H20F6N2O |
| Molecular Weight | 394.35500 |
| Flash Point | 212.5ºC |
| Exact Mass | 394.14800 |
| PSA | 45.15000 |
| LogP | 5.47490 |
| Index of Refraction | 1.499 |
| InChIKey | NEZJFNMPGLCANK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCCC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Quinolinemethanol,a-[2-[(1,1-dimethylethyl)amino]ethyl]-2,8-bis(trifluoromethyl) |
| WR 1848Q6 |
| 1-(2,8-bis-trifluoromethyl-quinolin-4-yl)-3-tert-butylamino-propan-1-ol |
| 3-(tert-Butylamino)-1-<2,8-bis-(trifluormethyl)-4-chinolyl)-propanol |