diethyl 2-[(2-fluorophenyl)methyl]propanedioate
Modify Date: 2025-10-04 16:58:08
![diethyl 2-[(2-fluorophenyl)methyl]propanedioate Structure](https://image.chemsrc.com/caspic/310/59223-72-2.png)
diethyl 2-[(2-fluorophenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-[(2-fluorophenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 59223-72-2 | Molecular Weight | 268.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(2-fluorophenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17FO4 |
|---|---|
| Molecular Weight | 268.28100 |
| Exact Mass | 268.11100 |
| PSA | 52.60000 |
| LogP | 2.11060 |
| InChIKey | HCFBTPSCLNVUJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1F)C(=O)OCC |
|
~60%
diethyl 2-[(2-f... CAS#:59223-72-2 |
| Literature: Houghton, Roy P.; Voyle, Martyn; Price, Raymond Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 5 p. 925 - 931 |
|
~70%
diethyl 2-[(2-f... CAS#:59223-72-2 |
| Literature: Farmitalia Carlo Erba S.r.l. Patent: US5446066 A1, 1995 ; |
| o-Fluorbenzyl-malonsaeure-diethylester |
| diethyl 2-(2-fluorophenyl)ethane-1,1-dicarboxylate |
| diethyl 2-(2-fluorobenzyl)malonate |
| diethyl 2-fluorobenzylmalonate |
| Propanedioic acid,[(2-fluorophenyl)methyl]-,diethyl ester |