N-[4-(4-methoxyphenyl)butyl]-N-prop-2-enylacetamide structure
|
Common Name | N-[4-(4-methoxyphenyl)butyl]-N-prop-2-enylacetamide | ||
|---|---|---|---|---|
| CAS Number | 59181-41-8 | Molecular Weight | 261.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(4-methoxyphenyl)butyl]-N-prop-2-enylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H23NO2 |
|---|---|
| Molecular Weight | 261.35900 |
| Exact Mass | 261.17300 |
| PSA | 29.54000 |
| LogP | 3.05240 |
| InChIKey | RHAKFOQHFZZAPD-UHFFFAOYSA-N |
| SMILES | C=CCN(CCCCc1ccc(OC)cc1)C(C)=O |
|
~%
N-[4-(4-methoxy... CAS#:59181-41-8 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |
|
~%
N-[4-(4-methoxy... CAS#:59181-41-8 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |
| Acetamide,N-[4-(4-methoxyphenyl)butyl]-N-2-propenyl |
| N-[4-(4-Methoxy-phenyl)-butyl)-N-acetyl-N-allyl-amin |