7-[3-(Dimethylamino)propoxy]-3-(4-pyridyl)coumarin
Modify Date: 2025-09-18 13:26:47
![7-[3-(Dimethylamino)propoxy]-3-(4-pyridyl)coumarin Structure](https://image.chemsrc.com/caspic/303/5913-19-9.png)
7-[3-(Dimethylamino)propoxy]-3-(4-pyridyl)coumarin structure
|
Common Name | 7-[3-(Dimethylamino)propoxy]-3-(4-pyridyl)coumarin | ||
|---|---|---|---|---|
| CAS Number | 5913-19-9 | Molecular Weight | 324.37400 | |
| Density | 1.202g/cm3 | Boiling Point | 519.2ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | 8-[3-(Dimethylamino)propoxy]-3-(4-pyridinyl)-2H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 519.2ºC at 760 mmHg |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.37400 |
| Flash Point | 267.8ºC |
| Exact Mass | 324.14700 |
| PSA | 55.57000 |
| LogP | 3.18550 |
| Index of Refraction | 1.591 |
| InChIKey | GIUKXARTXPBEFY-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOc1ccc2cc(-c3ccncc3)c(=O)oc2c1 |
|
~%
7-[3-(Dimethyla... CAS#:5913-19-9 |
| Literature: Moffett,R.B. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 446 - 449 |
| Theophylline,7-(3-(4-butyl-1-piperazinyl)-2-hydroxypropyl) |
| 7-[3-(4-butyl-piperazin-1-yl)-2-hydroxy-propyl]-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 7-[3-(4-butylpiperazin-1-yl)-2-hydroxypropyl]-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |
| 7-(3-dimethylamino-propoxy)-3-pyridin-4-yl-chromen-2-one |
| 7-(2-Hydroxy-3-(4-butyl-1-piperazinyl)propyl)theophylline |