N-(3-bromo-4-chlorophenyl)-2-(4-methoxyphenyl)acetamide
Modify Date: 2025-11-25 09:17:48
N-(3-bromo-4-chlorophenyl)-2-(4-methoxyphenyl)acetamide structure
|
Common Name | N-(3-bromo-4-chlorophenyl)-2-(4-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 591226-55-0 | Molecular Weight | 354.62600 | |
| Density | 1.506g/cm3 | Boiling Point | 519.1ºC at 760 mmHg | |
| Molecular Formula | C15H13BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | N-(3-bromo-4-chlorophenyl)-2-(4-methoxyphenyl)acetamide |
|---|
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 519.1ºC at 760 mmHg |
| Molecular Formula | C15H13BrClNO2 |
| Molecular Weight | 354.62600 |
| Flash Point | 267.7ºC |
| Exact Mass | 352.98200 |
| PSA | 38.33000 |
| LogP | 4.36530 |
| Index of Refraction | 1.635 |
| InChIKey | FRROQLPKRQCCOM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)Nc2ccc(Cl)c(Br)c2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |