ethyl 4-(trimethylsilylamino)benzoate structure
|
Common Name | ethyl 4-(trimethylsilylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 59096-06-9 | Molecular Weight | 237.37000 | |
| Density | 1.022g/cm3 | Boiling Point | 305.5ºC at 760 mmHg | |
| Molecular Formula | C12H19NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6ºC | |
| Name | ethyl 4-(trimethylsilylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 305.5ºC at 760 mmHg |
| Molecular Formula | C12H19NO2Si |
| Molecular Weight | 237.37000 |
| Flash Point | 138.6ºC |
| Exact Mass | 237.11900 |
| PSA | 38.33000 |
| LogP | 3.18310 |
| Index of Refraction | 1.517 |
| InChIKey | MBUKPTCGZZRZQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N[Si](C)(C)C)cc1 |
|
~97%
ethyl 4-(trimet... CAS#:59096-06-9 |
| Literature: Lebedev; Lebedeva; Sheludyakov; Ovcharuk; Kovaleva; Ustinova Russian Journal of General Chemistry, 2006 , vol. 76, # 7 p. 1069 - 1080 |
| Benzocaine,N-trimethylsilyl |
| 4-((Trimethylsilyl)amino)benzoic acid ethyl ester |
| BENZOIC ACID,4-((TRIMETHYLSILYL)AMINO)-,ETHYL ESTER |