1,2,4,5-tetrabromo-3-(2,3,5,6-tetrabromophenyl)benzene
Modify Date: 2025-08-25 17:52:31
1,2,4,5-tetrabromo-3-(2,3,5,6-tetrabromophenyl)benzene structure
|
Common Name | 1,2,4,5-tetrabromo-3-(2,3,5,6-tetrabromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 59080-41-0 | Molecular Weight | 785.37600 | |
| Density | 2.763g/cm3 | Boiling Point | 504.3ºC at 760 mmHg | |
| Molecular Formula | C12H2Br8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | 1,2,4,5-tetrabromo-3-(2,3,5,6-tetrabromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.763g/cm3 |
|---|---|
| Boiling Point | 504.3ºC at 760 mmHg |
| Molecular Formula | C12H2Br8 |
| Molecular Weight | 785.37600 |
| Flash Point | 248.9ºC |
| Exact Mass | 777.36200 |
| LogP | 9.45360 |
| Index of Refraction | 1.72 |
| InChIKey | IQIHDBRYKJLECA-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(Br)c(-c2c(Br)c(Br)cc(Br)c2Br)c1Br |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Biphenyl,2,2',3,3',5,5',6,6'-octabromo |
| 2,2',3,3',5,5',6,6'-Octabromo-1,1'-biphenyl |