4-((4-Chlorobenzyl)oxy)benzaldehyde structure
|
Common Name | 4-((4-Chlorobenzyl)oxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 59067-46-8 | Molecular Weight | 246.68900 | |
| Density | 1.247g/cm3 | Boiling Point | 393.9ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.7ºC | |
| Name | 4-[(4-chlorophenyl)methoxy]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 393.9ºC at 760 mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 164.7ºC |
| Exact Mass | 246.04500 |
| PSA | 26.30000 |
| LogP | 3.73150 |
| Index of Refraction | 1.615 |
| InChIKey | LYEQERPOWVBIQS-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OCc2ccc(Cl)cc2)cc1 |
| HS Code | 2913000090 |
|---|
|
~89%
4-((4-Chloroben... CAS#:59067-46-8 |
| Literature: Chemistry - An Asian Journal, , vol. 6, # 8 p. 2073 - 2079 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| MFCD00850629 |