2-(4-(benzyloxy)phenoxy)propanoic acid
Modify Date: 2025-08-27 14:23:50
2-(4-(benzyloxy)phenoxy)propanoic acid structure
|
Common Name | 2-(4-(benzyloxy)phenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 59058-37-6 | Molecular Weight | 272.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Propionic acid, 2-[p-(benzyloxy)phenoxy]- (6CI) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29600 |
| Exact Mass | 272.10500 |
| PSA | 55.76000 |
| LogP | 3.11750 |
| InChIKey | ATPBADOREFXKFS-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(OCc2ccccc2)cc1)C(=O)O |
|
~86%
2-(4-(benzyloxy... CAS#:59058-37-6 |
| Literature: The DuPont Merck Pharmaceutical Company Patent: US5696119 A1, 1997 ; |
|
~64%
2-(4-(benzyloxy... CAS#:59058-37-6 |
| Literature: Booth, Christopher J.; Gray, George W.; Toyne, Kenneth J.; Hardy, Judith Molecular Crystals and Liquid Crystals Science and Technology, Section A: Molecular Crystals and Liquid Crystals, 1992 , vol. 210, p. 31 - 58 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (R,S)-2-<4-(Benzyloxy)phenoxy>propanoic acid |
| 2-(4-Benzyloxyphenoxy)propionic acid |
| (+) 2-(4-benzyloxyphenoxy)propanoate |
| 2-<4-Benzyloxy-phenoxy>-propionsaeure |
| Propionic acid,2-[p-(benzyloxy)phenoxy]-(6CI)2-(4-Phenoxyphenoxy)ethanol |
| Propanoic acid,2-[4-(phenylmethoxy)phenoxy] |