AKOS B018383
Modify Date: 2025-08-31 16:30:56
AKOS B018383 structure
|
Common Name | AKOS B018383 | ||
|---|---|---|---|---|
| CAS Number | 590376-71-9 | Molecular Weight | 253.29700 | |
| Density | 1.62g/cm3 | Boiling Point | 479.685ºC at 760 mmHg | |
| Molecular Formula | C10H7NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.905ºC | |
| Name | (5E)-5-(2,3-Dihydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 479.685ºC at 760 mmHg |
| Molecular Formula | C10H7NO3S2 |
| Molecular Weight | 253.29700 |
| Flash Point | 243.905ºC |
| Exact Mass | 252.98700 |
| PSA | 133.99000 |
| LogP | 1.43350 |
| Index of Refraction | 1.759 |
| InChIKey | NLLGSRAFJAIEKU-QPJJXVBHSA-N |
| SMILES | O=C1NC(=S)SC1=Cc1cccc(O)c1O |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (5E)-5-(2,3-dihydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one(SALTDATA: FREE) |