5-chloro-2-[(4-chlorophenyl)methoxy]benzaldehyde structure
|
Common Name | 5-chloro-2-[(4-chlorophenyl)methoxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 590360-27-3 | Molecular Weight | 281.13400 | |
| Density | 1.34g/cm3 | Boiling Point | 412.1ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.2ºC | |
| Name | 5-chloro-2-[(4-chlorophenyl)methoxy]benzaldehyde |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 169.2ºC |
| Exact Mass | 280.00600 |
| PSA | 26.30000 |
| LogP | 4.38490 |
| Index of Refraction | 1.623 |
| InChIKey | OGLCKFZROZEABF-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Cl)ccc1OCc1ccc(Cl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |