Disulergine structure
|
Common Name | Disulergine | ||
|---|---|---|---|---|
| CAS Number | 59032-40-5 | Molecular Weight | 348.46300 | |
| Density | 1.36g/cm3 | Boiling Point | 544.8ºC at 760 mmHg | |
| Molecular Formula | C17H24N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.3ºC | |
| Name | Disulergine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 544.8ºC at 760 mmHg |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.46300 |
| Flash Point | 283.3ºC |
| Exact Mass | 348.16200 |
| PSA | 76.82000 |
| LogP | 2.68590 |
| Index of Refraction | 1.677 |
| InChIKey | VUEGYUOUAAVYAS-JGGQBBKZSA-N |
| SMILES | CN1CC(NS(=O)(=O)N(C)C)CC2c3cccc4[nH]cc(c34)CC21 |
|
~73%
Disulergine CAS#:59032-40-5 |
| Literature: Stutz; Stadler; Vigouret; Jaton European Journal of Medicinal Chemistry, 1982 , vol. 17, # 6 p. 537 - 541 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-dimethyl-N'-(6-methyl-ergolin-8-yl)-sulfamide |
| Sandoz 29-717 |
| Sulergine |