1-[amino(methoxy)phosphinothioyl]oxy-4-tert-butyl-2-chlorobenzene structure
|
Common Name | 1-[amino(methoxy)phosphinothioyl]oxy-4-tert-butyl-2-chlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 5902-52-3 | Molecular Weight | 293.75000 | |
| Density | 1.254g/cm3 | Boiling Point | 351ºC at 760 mmHg | |
| Molecular Formula | C11H17ClNO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | 1-[amino(methoxy)phosphinothioyl]oxy-4-tert-butyl-2-chlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760 mmHg |
| Molecular Formula | C11H17ClNO2PS |
| Molecular Weight | 293.75000 |
| Flash Point | 166.1ºC |
| Exact Mass | 293.04100 |
| PSA | 86.38000 |
| LogP | 5.19680 |
| Index of Refraction | 1.559 |
| InChIKey | HAJQRNZSYDJREE-UHFFFAOYSA-N |
| SMILES | COP(N)(=S)Oc1ccc(C(C)(C)C)cc1Cl |
|
~%
1-[amino(methox... CAS#:5902-52-3 |
| Literature: Dow Chem. Co. Patent: DE1075609 , 1957 ; Full Text Show Details Dow Chem. Co. Patent: US2836612 , 1956 ; |
| Phosphoramidothioic acid,O-(4-tert-butyl-2-chlorophenyl) O-methyl ester |
| Dowco 109 |
| Phenol,4-tert-butyl-2-chloro-,O-ester with O-methyl phosphoramidothioate |
| Phosphoramidothioic acid,methyl-,O-(tert-butyl-2-chlorophenyl) ester |
| amidothiophosphoric acid O-(4-tert-butyl-2-chloro-phenyl ester)-O'-methyl ester |
| Narlene |
| Phosphoramidothioic acid,O-(2-chloro-4-(1,1-dimethylethyl)phenyl) O-methyl ester |
| Amidothiophosphorsaeure-O-(4-tert-butyl-2-chlor-phenylester)-O'-methylester |
| o-(4-tert-butyl-2-chlorophenyl)o-methyl phosphoramidothionate |