Prizidilol structure
|
Common Name | Prizidilol | ||
|---|---|---|---|---|
| CAS Number | 59010-44-5 | Molecular Weight | 331.41300 | |
| Density | 1.193g/cm3 | Boiling Point | 595ºC at 760 mmHg | |
| Molecular Formula | C17H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.7ºC | |
| Name | Prizidilol |
|---|
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 595ºC at 760 mmHg |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.41300 |
| Flash Point | 313.7ºC |
| Exact Mass | 331.20100 |
| PSA | 105.32000 |
| LogP | 2.72120 |
| Index of Refraction | 1.6 |
| InChIKey | QGONODUKOFNSOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1-c1ccc(NN)nn1 |
|
~%
Prizidilol CAS#:59010-44-5 |
| Literature: Smith Kline and French Laboratories Limited Patent: US4053601 A1, 1977 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |