5-Cumyl-o-anisidine hydrochloride
Modify Date: 2025-08-28 19:31:21
5-Cumyl-o-anisidine hydrochloride structure
|
Common Name | 5-Cumyl-o-anisidine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 58999-69-2 | Molecular Weight | 277.78900 | |
| Density | N/A | Boiling Point | 372ºC at 760 mmHg | |
| Molecular Formula | C16H20ClNO | Melting Point | 180-182ºC | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 5-Cumyl-o-anisidine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 372ºC at 760 mmHg |
|---|---|
| Melting Point | 180-182ºC |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.78900 |
| Flash Point | 175.4ºC |
| Exact Mass | 277.12300 |
| PSA | 35.25000 |
| LogP | 4.98650 |
| InChIKey | RWWWQPKHGYNPPA-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)(C)c2ccccc2)cc1N.Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methoxy-5-(2-phenylpropan-2-yl)aniline,hydrochloride |