ALLYL-[4-(4-NITRO-PHENYL)-THIAZOL-2-YL]-AMINE
Modify Date: 2025-09-23 16:31:25
![ALLYL-[4-(4-NITRO-PHENYL)-THIAZOL-2-YL]-AMINE Structure](https://image.chemsrc.com/caspic/264/5898-41-9.png)
ALLYL-[4-(4-NITRO-PHENYL)-THIAZOL-2-YL]-AMINE structure
|
Common Name | ALLYL-[4-(4-NITRO-PHENYL)-THIAZOL-2-YL]-AMINE | ||
|---|---|---|---|---|
| CAS Number | 5898-41-9 | Molecular Weight | 261.30000 | |
| Density | 1.327g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C12H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 4-(4-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.30000 |
| Flash Point | 214.2ºC |
| Exact Mass | 261.05700 |
| PSA | 102.21000 |
| LogP | 3.26130 |
| Index of Refraction | 1.657 |
| InChIKey | RTEQUIPYSDUEKA-UHFFFAOYSA-N |
| SMILES | C=CCNc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
ALLYL-[4-(4-NIT... CAS#:5898-41-9 |
| Literature: Gagiu; Csavassy; Valau Bulletin de la Societe chimique de France, 1966 , vol. 2, p. 686 - 689 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Allyl-[4-(4-nitro-phenyl)-thiazol-2-yl]-amine |
| [4-(4-nitrophenyl)(1,3-thiazol-2-yl)]prop-2-enylamine |
| F0300-0005 |
| 2-Allylamino-4-<4-nitro-phenyl>-thiazol |
| N-allyl-4-(4-nitrophenyl)-1,3-thiazol-2-amine |