1-[2-(4-CHLORO-PHENYL)-INDOLIZIN-3-YL]-ETHANONE structure
|
Common Name | 1-[2-(4-CHLORO-PHENYL)-INDOLIZIN-3-YL]-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 58963-35-2 | Molecular Weight | 269.72600 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(4-chlorophenyl)indolizin-3-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Exact Mass | 269.06100 |
| PSA | 21.48000 |
| LogP | 4.46230 |
| Index of Refraction | 1.622 |
| InChIKey | AVVAFECDGAMDDO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)cc2ccccn12 |
| HS Code | 2933990090 |
|---|
|
~%
1-[2-(4-CHLORO-... CAS#:58963-35-2 |
| Literature: Zhou, Jian; Yuefei, Hu; Hongwen, Hu Synthesis, 1999 , # 1 p. 166 - 170 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| avvafecdgamddo-uhfffaoysa |
| gl-0853 |