Methylsulphonic acid salt of 3,3,5-trimethylcyclohexyl apovincaminate structure
|
Common Name | Methylsulphonic acid salt of 3,3,5-trimethylcyclohexyl apovincaminate | ||
|---|---|---|---|---|
| CAS Number | 58932-86-8 | Molecular Weight | 542.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H42N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methylsulphonic acid salt of 3,3,5-trimethylcyclohexyl apovincaminate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H42N2O5S |
|---|---|
| Molecular Weight | 542.73000 |
| Exact Mass | 542.28100 |
| PSA | 97.22000 |
| LogP | 6.86590 |
| InChIKey | BCHXUZSLWSFIKB-MBLZCJMFSA-N |
| SMILES | CCC12C=C(C(=O)OC3CC(C)CC(C)(C)C3)n3c4c(c5ccccc53)CCN(CCC1)C42.CS(=O)(=O)O |
| slc 135 |