N-[2-(benzenesulfonyl)ethyl]-N-methylacetamide structure
|
Common Name | N-[2-(benzenesulfonyl)ethyl]-N-methylacetamide | ||
|---|---|---|---|---|
| CAS Number | 58921-76-9 | Molecular Weight | 241.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(benzenesulfonyl)ethyl]-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15NO3S |
|---|---|
| Molecular Weight | 241.30700 |
| Exact Mass | 241.07700 |
| PSA | 62.83000 |
| LogP | 2.01940 |
| InChIKey | VQXGUOSGVZMBTN-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)CCS(=O)(=O)c1ccccc1 |
|
~%
N-[2-(benzenesu... CAS#:58921-76-9 |
| Literature: Marshall,D.R. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 1898 - 1909 |
| Acetamide,N-methyl-N-[2-(phenylsulfonyl)ethyl] |