2-benzothiazol-2-ylsulfanyl-N-[4-(hydrazinecarbonyl)phenyl]acetamide structure
|
Common Name | 2-benzothiazol-2-ylsulfanyl-N-[4-(hydrazinecarbonyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 58915-17-6 | Molecular Weight | 358.43800 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(hydrazinecarbonyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.43800 |
| Exact Mass | 358.05600 |
| PSA | 150.65000 |
| LogP | 3.79480 |
| Index of Refraction | 1.742 |
| InChIKey | RPKYJMMNBLODPY-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc(NC(=O)CSc2nc3ccccc3s2)cc1 |
|
~%
2-benzothiazol-... CAS#:58915-17-6 |
| Literature: Misra; Barthwal; Parmar; Singh; Stenberg Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 3 p. 405 - 408 |
|
~%
2-benzothiazol-... CAS#:58915-17-6 |
| Literature: Misra; Barthwal; Parmar; Singh; Stenberg Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 3 p. 405 - 408 |
|
~%
2-benzothiazol-... CAS#:58915-17-6 |
| Literature: Misra; Barthwal; Parmar; Singh; Stenberg Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 3 p. 405 - 408 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-benzothiazol-2-ylsulfanyl-N-(4-hydrazinocarbonyl-phenyl)-acetamide |