ethyl 4-[(2-benzooxazol-2-ylsulfanylacetyl)amino]benzoate
Modify Date: 2025-09-12 11:20:17
![ethyl 4-[(2-benzooxazol-2-ylsulfanylacetyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/045/58915-09-6.png)
ethyl 4-[(2-benzooxazol-2-ylsulfanylacetyl)amino]benzoate structure
|
Common Name | ethyl 4-[(2-benzooxazol-2-ylsulfanylacetyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 58915-09-6 | Molecular Weight | 356.39600 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.39600 |
| Exact Mass | 356.08300 |
| PSA | 106.73000 |
| LogP | 3.80830 |
| Index of Refraction | 1.654 |
| InChIKey | ZNPNSUPAXSQOIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nc3ccccc3o2)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
ethyl 4-[(2-ben... CAS#:58915-09-6 |
| Literature: Misra; Barthwal; Parmar; Singh; Stenberg Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 3 p. 405 - 408 |
![Benzoic acid,4-[(2-chloroacetyl)amino]-, ethyl ester structure](https://image.chemsrc.com/caspic/371/26226-72-2.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ETHYL 4-[(2-BENZOOXAZOL-2-YLSULFANYLACETYL)AMINO]BENZOATE |
| 4-(2-benzooxazol-2-ylsulfanyl-acetylamino)-benzoic acid ethyl ester |