4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 2-chloro-N,N-dimethyl-10H-phenothiazine-10-propylamine (1:1) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 2-chloro-N,N-dimethyl-10H-phenothiazine-10-propylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 58901-20-5 | Molecular Weight | 707.23400 | |
| Density | N/A | Boiling Point | 642.7ºC at 760 mmHg | |
| Molecular Formula | C40H35ClN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.5ºC | |
| Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid,3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 642.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C40H35ClN2O6S |
| Molecular Weight | 707.23400 |
| Flash Point | 356.5ºC |
| Exact Mass | 706.19000 |
| PSA | 146.84000 |
| LogP | 9.35080 |
| InChIKey | LCKBXWYKBWCAOP-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic) acid,compound with 2-chloro-N,N-dimethyl-10H-phenothiazine-10-propylamine (1:1) |
| 3-(2-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
| EINECS 261-487-5 |