4-(Trifluoromethyl)quinoline-2-carboxylic acid
Modify Date: 2025-09-10 22:58:59
4-(Trifluoromethyl)quinoline-2-carboxylic acid structure
|
Common Name | 4-(Trifluoromethyl)quinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 588702-67-4 | Molecular Weight | 241.16600 | |
| Density | 1.481g/cm3 | Boiling Point | 351.61ºC at 760 mmHg | |
| Molecular Formula | C11H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.448ºC | |
| Name | 4-(Trifluoromethyl)quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.481g/cm3 |
|---|---|
| Boiling Point | 351.61ºC at 760 mmHg |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.16600 |
| Flash Point | 166.448ºC |
| Exact Mass | 241.03500 |
| PSA | 50.19000 |
| LogP | 2.95180 |
| Index of Refraction | 1.579 |
| InChIKey | YGGNZDRZJWUYRO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(F)(F)F)c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| wt610 |
| MFCD06796588 |
| 4-trifluoromethyl-quinoline-2-carboxylic acid |