1,3-Dichloro-4,4,5,5-tetramethyl-2-imidazolidinone structure
|
Common Name | 1,3-Dichloro-4,4,5,5-tetramethyl-2-imidazolidinone | ||
|---|---|---|---|---|
| CAS Number | 58816-20-9 | Molecular Weight | 211.08900 | |
| Density | 1.31g/cm3 | Boiling Point | 214.4ºC at 760mmHg | |
| Molecular Formula | C7H12Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83.5ºC | |
| Name | 1,3-dichloro-4,4,5,5-tetramethylimidazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 214.4ºC at 760mmHg |
| Molecular Formula | C7H12Cl2N2O |
| Molecular Weight | 211.08900 |
| Flash Point | 83.5ºC |
| Exact Mass | 210.03300 |
| PSA | 23.55000 |
| LogP | 2.46460 |
| Index of Refraction | 1.536 |
| InChIKey | BROYWHABVCPAPN-UHFFFAOYSA-N |
| SMILES | CC1(C)N(Cl)C(=O)N(Cl)C1(C)C |
|
~76%
1,3-Dichloro-4,... CAS#:58816-20-9 |
| Literature: Barnela; Worley; Williams Journal of Pharmaceutical Sciences, 1987 , vol. 76, # 3 p. 245 - 247 |
|
~0%
1,3-Dichloro-4,... CAS#:58816-20-9 |
| Literature: Barnela; Worley; Williams Journal of Pharmaceutical Sciences, 1987 , vol. 76, # 3 p. 245 - 247 |
| 1,3-dichloro4,4,5,5,-tetramethyl-2-imidazolidinone |
| 1,3-dichloro-4,4,5,5-tetramethyl-imidazolidin-2-one |
| DTID |