decanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1)
Modify Date: 2025-09-23 15:12:00
decanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | decanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 58793-73-0 | Molecular Weight | 321.45300 | |
| Density | N/A | Boiling Point | 269.6ºC at 760mmHg | |
| Molecular Formula | C16H35NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.8ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,decanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 269.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H35NO5 |
| Molecular Weight | 321.45300 |
| Flash Point | 121.8ºC |
| Exact Mass | 321.25200 |
| PSA | 101.23000 |
| LogP | 1.47700 |
| InChIKey | GKHDHUDIDOQOFX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)O.OCCN(CCO)CCO |
| Decanoic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| EINECS 261-445-6 |
| Decanoic acid,triethanolamine salt |
| Decanoic acid,compd. with 2,2',2''-nitrilotris(ethanol) (1:1) |
| decanoic acid-2,2',2''-nitrilotriethanol (1:1) |