POLYIMIDE
Modify Date: 2025-09-07 18:30:09
POLYIMIDE structure
|
Common Name | POLYIMIDE | ||
|---|---|---|---|---|
| CAS Number | 58698-66-1 | Molecular Weight | 746.63400 | |
| Density | N/A | Boiling Point | 638.8ºC at 760mmHg | |
| Molecular Formula | C41H22N4O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.2ºC | |
| Name | 2,4-diisocyanato-1-methylbenzene,5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 638.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C41H22N4O11 |
| Molecular Weight | 746.63400 |
| Flash Point | 286.2ºC |
| Exact Mass | 746.12900 |
| PSA | 221.53000 |
| LogP | 6.68040 |
| InChIKey | BAHMGCYMATVYCQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.O=C(c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| 1,3-Isobenzofurandione,5,5'-carbonylbis-,polymer with 2,4-diisocyanato-1-methylbenzene and 1,1'-methylenebis(4-isocyanatobenzene) |
| Benzophenonetetracarboxylic dianhydride,2,4-toluenediisocyanate,4,4'-methylenediphenyldiisocyanate polyimide |