2,11,20,29-tetra-tert-butyl-2,3-naphthalocyanine structure
|
Common Name | 2,11,20,29-tetra-tert-butyl-2,3-naphthalocyanine | ||
|---|---|---|---|---|
| CAS Number | 58687-99-3 | Molecular Weight | 939.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C64H58N8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2,11,20,29-tetra-tert-butyl-2,3-naphthalocyanine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C64H58N8 |
|---|---|
| Molecular Weight | 939.19900 |
| Exact Mass | 938.47800 |
| PSA | 101.98000 |
| LogP | 12.40030 |
| InChIKey | FZJGGSUDHJDHRJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2cc3c(cc2c1)-c1nc2nc(nc4[nH]c(nc5[nH]c(nc-3n1)c1cc3cc(C(C)(C)C)ccc3cc51)c1cc3cc(C(C)(C)C)ccc3cc41)-c1cc3cc(C(C)(C)C)ccc3cc1-2 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
~%
2,11,20,29-tetr... CAS#:58687-99-3 |
| Literature: Leznoff, Clifford C.; McKeown, Neil B. Journal of Organic Chemistry, 1990 , vol. 55, # 4 p. 2186 - 2190 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,11,20,29-tetra-tert-butyl-37H,39H-tetranaphtho[2,3-b,2',3'-g,2'',3''-l,2''',3'''-q]porphyrazine |
| Tetra-tert-butylnaphthalocyanine |
| MFCD00192468 |