3-methyl-2-phenyl-1H-[1,4]benzodioxino[2,3-f]indole structure
|
Common Name | 3-methyl-2-phenyl-1H-[1,4]benzodioxino[2,3-f]indole | ||
|---|---|---|---|---|
| CAS Number | 58679-42-8 | Molecular Weight | 313.34900 | |
| Density | 1.294g/cm3 | Boiling Point | 508.8ºC at 760 mmHg | |
| Molecular Formula | C21H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
| Name | 3-methyl-2-phenyl-1H-[1,4]benzodioxino[2,3-f]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 508.8ºC at 760 mmHg |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.34900 |
| Flash Point | 180.2ºC |
| Exact Mass | 313.11000 |
| PSA | 34.25000 |
| LogP | 6.04130 |
| Index of Refraction | 1.704 |
| InChIKey | CBNMZAWUDBURMJ-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)[nH]c2cc3c(cc12)Oc1ccccc1O3 |
|
~%
3-methyl-2-phen... CAS#:58679-42-8 |
| Literature: Saint-Ruf,G. et al. Journal of Heterocyclic Chemistry, 1975 , vol. 12, p. 1069 - 1071 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-2-phenylindolo<5,6-b>benzo-1,4-dioxin |
| 3-methyl-2-phenyl-1H-benzo[5,6][1,4]dioxino[2,3-f]indole |