1-chloro-4-(1-fluoro-2-iodo-1-phenylethyl)benzene structure
|
Common Name | 1-chloro-4-(1-fluoro-2-iodo-1-phenylethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 58617-64-4 | Molecular Weight | 360.59300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClFI | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-(1-fluoro-2-iodo-1-phenylethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClFI |
|---|---|
| Molecular Weight | 360.59300 |
| Exact Mass | 359.95800 |
| LogP | 4.98810 |
| InChIKey | TZIKMCLQUPJGFC-UHFFFAOYSA-N |
| SMILES | FC(CI)(c1ccccc1)c1ccc(Cl)cc1 |
|
~15%
1-chloro-4-(1-f... CAS#:58617-64-4 |
| Literature: Gregorcic, Ana; Zupan, Marko Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 8 p. 3083 - 3086 |
| Benzene,1-chloro-4-(1-fluoro-2-iodo-1-phenylethyl) |
| 1-fluoro-2-iodo-1-phenyl-1-(4'-chlorophenyl)ethane |