2-(4,5-dihydro-5-oxo-3-phenyl-1H-pyrazol-1-yl)benzenesulphonic acid structure
|
Common Name | 2-(4,5-dihydro-5-oxo-3-phenyl-1H-pyrazol-1-yl)benzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 5855-68-5 | Molecular Weight | 316.33200 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4,5-dihydro-5-oxo-3-phenyl-1H-pyrazol-1-yl)benzenesulphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.33200 |
| Exact Mass | 316.05200 |
| PSA | 95.42000 |
| LogP | 2.65570 |
| Index of Refraction | 1.677 |
| InChIKey | LJMVVICUDHEKNL-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)=NN1c1ccccc1S(=O)(=O)O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4,5-Dihydro-5-oxo-3-phenyl-1H-pyrazol-1-yl)benzenesulfonic acid |
| 2-(5-keto-3-phenyl-4H-pyrazol-1-yl)benzenesulfonic acid |
| 2-(5-oxo-3-phenyl-4H-pyrazol-1-yl)benzenesulfonic acid |
| 1-(2-sulfophenyl)-3-phenyl-5-pyrazolone |