1-(4,5-dimethoxy-2-nitrophenyl)-N-prop-2-enylmethanimine structure
|
Common Name | 1-(4,5-dimethoxy-2-nitrophenyl)-N-prop-2-enylmethanimine | ||
|---|---|---|---|---|
| CAS Number | 58522-72-8 | Molecular Weight | 250.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4,5-dimethoxy-2-nitrophenyl)-N-prop-2-enylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14N2O4 |
|---|---|
| Molecular Weight | 250.25100 |
| Exact Mass | 250.09500 |
| PSA | 76.64000 |
| LogP | 2.74010 |
| InChIKey | QDTPJIMFGCRHJJ-UHFFFAOYSA-N |
| SMILES | C=CCN=Cc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~%
1-(4,5-dimethox... CAS#:58522-72-8 |
| Literature: Morton-Norwich Products, Inc. Patent: US3966760 A1, 1976 ; |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Nitroveratrylideneallylamine |
| 2-Propen-1-amine,N-[(4,5-dimethoxy-2-nitrophenyl)methylene] |