acid blue 29 structure
|
Common Name | acid blue 29 | ||
|---|---|---|---|---|
| CAS Number | 5850-35-1 | Molecular Weight | 616.49100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H14N6Na2O9S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | acid blue 29 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H14N6Na2O9S2 |
|---|---|
| Molecular Weight | 616.49100 |
| Exact Mass | 616.00600 |
| PSA | 272.67000 |
| LogP | 7.94080 |
| Appearance of Characters | Powder | Black |
| InChIKey | QCWPZYSLMIXIHM-UHFFFAOYSA-L |
| SMILES | Nc1c(N=Nc2cccc([N+](=O)[O-])c2)c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccccc3)c(O)c12.[Na+].[Na+] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Einecs 227-449-7 |
| C.I. Acid Blue 29,disodium salt |
| MFCD00009960 |
| Acid bule 29 |