1-methyl-4-pent-4-yn-2-yloxysulfonyl-benzene structure
|
Common Name | 1-methyl-4-pent-4-yn-2-yloxysulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 58456-48-7 | Molecular Weight | 238.30300 | |
| Density | 1.168g/cm3 | Boiling Point | 358.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | pent-4-yn-2-yl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 358.5ºC at 760 mmHg |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.30300 |
| Flash Point | 170.6ºC |
| Exact Mass | 238.06600 |
| PSA | 51.75000 |
| LogP | 3.19290 |
| Index of Refraction | 1.528 |
| InChIKey | FUXZPGSGEZVNMH-UHFFFAOYSA-N |
| SMILES | C#CCC(C)OS(=O)(=O)c1ccc(C)cc1 |
|
~94%
1-methyl-4-pent... CAS#:58456-48-7 |
| Literature: Dai; Katzenellenbogen Journal of Organic Chemistry, 1993 , vol. 58, # 7 p. 1900 - 1908 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Pentin-1-ol-4-p-toluolsulfonat |
| 4-Pentyn-2-yl tosylate |
| pent-4-yn-2-yl p-toluenesulfonate |
| 1-methyl-4-pent-4-yn-2-yloxysulfonyl-benzene |