Dihydroresveratrol structure
|
Common Name | Dihydroresveratrol | ||
|---|---|---|---|---|
| CAS Number | 58436-28-5 | Molecular Weight | 230.259 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 430.3±14.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9±14.7 °C | |
Use of DihydroresveratrolDihydroresveratrol, a potent phytoestrogen, is a hormone receptor modulator. Dihydroresveratrol exhibits proliferative effects in androgen-independent prostate and breast cancer cells at picomolar and nanomolar concentrations[1]. |
| Name | 3,3',5-trihydroxybibenzyl |
|---|---|
| Synonym | More Synonyms |
| Description | Dihydroresveratrol, a potent phytoestrogen, is a hormone receptor modulator. Dihydroresveratrol exhibits proliferative effects in androgen-independent prostate and breast cancer cells at picomolar and nanomolar concentrations[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Treatment with 0.1 nM-0.1 μM of Dihydroresveratrol significantly increases the growth of PC-3 prostate cancer cells[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.3±14.0 °C at 760 mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.259 |
| Flash Point | 210.9±14.7 °C |
| Exact Mass | 230.094299 |
| PSA | 60.69000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | HITJFUSPLYBJPE-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CCc2cc(O)cc(O)c2)cc1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| dihydroresverantrol |
| 3',4,5'-trihydroxydihydrostilbene |
| Dihydroresveratrol |
| Dihydro-resveratrol |
| 5-[2-(4-Hydroxyphenyl)ethyl]-1,3-benzenediol |
| 5-[2-(4-Hydroxyphenyl)ethyl]benzene-1,3-diol |
| 3,4',5-Trihydroxybibenzyl |
| 1,3-Benzenediol, 5-[2-(4-hydroxyphenyl)ethyl]- |
| 3ftu |
| 3,5,4'-trihydroxybibenzyl |
| RE2 |