(8-methoxy-3,3-dimethyl-2,4,7-trioxabicyclo[4.3.0]non-9-yl) benzoate structure
|
Common Name | (8-methoxy-3,3-dimethyl-2,4,7-trioxabicyclo[4.3.0]non-9-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 58365-85-8 | Molecular Weight | 308.32600 | |
| Density | 1.24g/cm3 | Boiling Point | 400.6ºC at 760 mmHg | |
| Molecular Formula | C16H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6ºC | |
| Name | (6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl) benzoate |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760 mmHg |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.32600 |
| Flash Point | 175.6ºC |
| Exact Mass | 308.12600 |
| PSA | 63.22000 |
| LogP | 1.73480 |
| Index of Refraction | 1.541 |
| InChIKey | YGSMVOHGILASOG-UHFFFAOYSA-N |
| SMILES | COC1OC2COC(C)(C)OC2C1OC(=O)c1ccccc1 |
|
~%
(8-methoxy-3,3-... CAS#:58365-85-8 |
| Literature: Schaub; Weiss Journal of the American Chemical Society, 1958 , vol. 80, p. 4683,4689 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |