N-Hydroxy Amobarbital
Modify Date: 2025-09-24 17:28:29
N-Hydroxy Amobarbital structure
|
Common Name | N-Hydroxy Amobarbital | ||
|---|---|---|---|---|
| CAS Number | 58359-49-2 | Molecular Weight | 242.27200 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Hydroxy Amobarbital |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27200 |
| Exact Mass | 242.12700 |
| PSA | 90.20000 |
| LogP | 1.50040 |
| Index of Refraction | 1.499 |
| InChIKey | YEUMGUWIUSGGRU-UHFFFAOYSA-N |
| SMILES | CCC1(CCC(C)C)C(=O)NC(=O)N(O)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-ethyl-1-hydroxy-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |