2-butyl-4,6-dichloro-5-nitropyrimidine structure
|
Common Name | 2-butyl-4,6-dichloro-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 58289-15-9 | Molecular Weight | 250.08200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-butyl-4,6-dichloro-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9Cl2N3O2 |
|---|---|
| Molecular Weight | 250.08200 |
| Exact Mass | 249.00700 |
| PSA | 71.60000 |
| LogP | 3.55740 |
| InChIKey | JNBSKCDUWHAODZ-UHFFFAOYSA-N |
| SMILES | CCCCc1nc(Cl)c([N+](=O)[O-])c(Cl)n1 |
|
~%
2-butyl-4,6-dic... CAS#:58289-15-9 |
| Literature: Brown Journal of the Chemical Society, 1956 , p. 2312 |
| 2-butyl-4,6-dichloro-5-nitro-pyrimidine |
| Pyrimidine,2-butyl-4,6-dichloro-5-nitro |
| 2-Butyl-4,6-dichlor-5-nitro-pyrimidin |