2-iodo-7-nitronaphthalene structure
|
Common Name | 2-iodo-7-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 58258-69-8 | Molecular Weight | 299.06500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-7-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6INO2 |
|---|---|
| Molecular Weight | 299.06500 |
| Exact Mass | 298.94400 |
| PSA | 45.82000 |
| LogP | 3.87580 |
| InChIKey | VMUNEKSHQMHGHI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ccc(I)cc2c1 |
|
~%
2-iodo-7-nitron... CAS#:58258-69-8 |
| Literature: Hodgson; Ward Journal of the Chemical Society, 1947 , p. 327,330, 331 |
| 2-Jod-7-nitro-naphthalin |
| 2-iodo-7-nitro-naphthalene |
| 2-Iod-7-nitro-naphthalin |