6,7-dichloro-9,10-dioxoanthracene-1-carboxylic acid structure
|
Common Name | 6,7-dichloro-9,10-dioxoanthracene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 58236-19-4 | Molecular Weight | 321.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-dichloro-9,10-dioxoanthracene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H6Cl2O4 |
|---|---|
| Molecular Weight | 321.11200 |
| Exact Mass | 319.96400 |
| PSA | 71.44000 |
| LogP | 3.46700 |
| InChIKey | LTQQNOCPMNSDJT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C(=O)c1cc(Cl)c(Cl)cc1C2=O |
|
~%
6,7-dichloro-9,... CAS#:58236-19-4 |
| Literature: Traxler; Moats; Lira; Huffman Journal of Pharmaceutical Sciences, 1975 , vol. 64, # 12 p. 1943 - 1949 |
|
~%
6,7-dichloro-9,... CAS#:58236-19-4 |
| Literature: Traxler; Moats; Lira; Huffman Journal of Pharmaceutical Sciences, 1975 , vol. 64, # 12 p. 1943 - 1949 |
| 6,7-Dichloroanthraquinone-1-carboxylic acid |
| 6,7-dichloro-9,10-dioxo-9,10-dihydro-anthracene-1-carboxylic acid |
| 1-Anthracenecarboxylic acid,6,7-dichloro-9,10-dihydro-9,10-dioxo |
| 6.7-Dichlor-anthrachinon-1-carbonsaeure |
| 6,7-Dichlor-9,10-dioxo-9,10-dihydro-anthracen-1-carbonsaeure |
| 6,7-Dichloro-9,10-dioxo-9,10-dihydro-1-anthracenecarboxylic acid |