1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene
1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene structure
|
Common Name | 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 58235-52-2 | Molecular Weight | 350.36300 | |
| Density | 1.152g/cm3 | Boiling Point | 434.3ºC at 760 mmHg | |
| Molecular Formula | C18H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
Summary: 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene (CAS号：58235-52-2)，molecular formula：C18H22O7，molecular weight：350.36300。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 434.3ºC at 760 mmHg |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.36300 |
| Flash Point | 174.1ºC |
| Exact Mass | 350.13700 |
| PSA | 64.61000 |
| LogP | 3.53050 |
| Index of Refraction | 1.522 |
| InChIKey | JCSTZIOMVRIGPW-UHFFFAOYSA-N |
| SMILES | COc1cc(Oc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~47%
1,2,3-trimethox... CAS#:58235-52-2 |
| Literature: Paizs, Csaba; Bartlewski-Hof, Ulrike; Retey, Janos Chemistry - A European Journal, 2007 , vol. 13, # 10 p. 2805 - 2811 |
|
~%
1,2,3-trimethox... CAS#:58235-52-2 |
| Literature: Paizs, Csaba; Bartlewski-Hof, Ulrike; Retey, Janos Chemistry - A European Journal, 2007 , vol. 13, # 10 p. 2805 - 2811 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4,5,3',4',5'-Hexamethoxydiphenylether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: LogP of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is 3.53050. |
| Q: What is the boiling point of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: Boiling point of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is 434.3ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: SMILES notation of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is COc1cc(Oc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC. |
| Q: What is the InChIKey of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: InChIKey of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is JCSTZIOMVRIGPW-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: The English name of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene. |
| Q: What English synonyms does 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene have? |
| A: English synonyms of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene: 3,4,5,3',4',5'-Hexamethoxydiphenylether. |
| Q: What is the molecular formula of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: Molecular formula of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is C18H22O7. |
| Q: What is the molecular weight of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: Molecular weight of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is 350.36300. |
| Q: What is the polar surface area (PSA) of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene? |
| A: Polar surface area (PSA) of 1,2,3-trimethoxy-5-(3,4,5-trimethoxyphenoxy)benzene is 64.61000. |
| Q: What is the Chinese name of 58235-52-2? |
| A: Chinese name of 58235-52-2 is 58235-52-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |