1-Propanol, 3-chloro-,1-(4-nitrobenzoate) structure
|
Common Name | 1-Propanol, 3-chloro-,1-(4-nitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 58168-11-9 | Molecular Weight | 243.64400 | |
| Density | 1.327g/cm3 | Boiling Point | 388.9ºC at 760mmHg | |
| Molecular Formula | C10H10ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | 3-chloropropyl 4-nitrobenzoate |
|---|
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 388.9ºC at 760mmHg |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.64400 |
| Flash Point | 189ºC |
| Exact Mass | 243.03000 |
| PSA | 72.12000 |
| LogP | 2.90370 |
| Index of Refraction | 1.552 |
| InChIKey | AODHIKQFOZZUBA-UHFFFAOYSA-N |
| SMILES | O=C(OCCCCl)c1ccc([N+](=O)[O-])cc1 |
|
~57%
1-Propanol, 3-c... CAS#:58168-11-9 |
| Literature: Xin, Yang-Chun; Shi, Shi-Hui; Xie, Dong-Dong; Hui, Xin-Ping; Xu, Peng-Fei European Journal of Organic Chemistry, 2011 , # 32 p. 6527 - 6531 |
|
~%
1-Propanol, 3-c... CAS#:58168-11-9 |
| Literature: Cope; McElvain Journal of the American Chemical Society, 1931 , vol. 53, p. 1587,1589 |