4-Cyclopentene-1,3-dione,2-[(3,4,5-trimethoxyphenyl)methylene]- structure
|
Common Name | 4-Cyclopentene-1,3-dione,2-[(3,4,5-trimethoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 58161-69-6 | Molecular Weight | 274.26900 | |
| Density | 1.276g/cm3 | Boiling Point | 475.1ºC at 760mmHg | |
| Molecular Formula | C15H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 2-[(3,4,5-trimethoxyphenyl)methylidene]cyclopent-4-ene-1,3-dione |
|---|
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 475.1ºC at 760mmHg |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.26900 |
| Flash Point | 213.4ºC |
| Exact Mass | 274.08400 |
| PSA | 61.83000 |
| LogP | 1.80380 |
| Index of Refraction | 1.601 |
| InChIKey | MXWOWFVKDKDJOL-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2C(=O)C=CC2=O)cc(OC)c1OC |
|
~%
4-Cyclopentene-... CAS#:58161-69-6 |
| Literature: Inayama,S. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 433 - 436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |