4-Cyclopentene-1,3-dione,2-[(4-hydroxy-3,5-dimethoxyphenyl)methylene]- structure
|
Common Name | 4-Cyclopentene-1,3-dione,2-[(4-hydroxy-3,5-dimethoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 58161-67-4 | Molecular Weight | 260.24200 | |
| Density | 1.375g/cm3 | Boiling Point | 485.3ºC at 760mmHg | |
| Molecular Formula | C14H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | 2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]cyclopent-4-ene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760mmHg |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24200 |
| Flash Point | 187.8ºC |
| Exact Mass | 260.06800 |
| PSA | 72.83000 |
| LogP | 1.50080 |
| Index of Refraction | 1.647 |
| InChIKey | BKCLHNZUGLBFEM-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2C(=O)C=CC2=O)cc(OC)c1O |
|
~%
4-Cyclopentene-... CAS#:58161-67-4 |
| Literature: Inayama,S. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 433 - 436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| kih 202 |