Benzenemethanol, 2-nitro-a-(nitromethyl)-, 1-nitrate structure
|
Common Name | Benzenemethanol, 2-nitro-a-(nitromethyl)-, 1-nitrate | ||
|---|---|---|---|---|
| CAS Number | 5816-93-3 | Molecular Weight | 257.15700 | |
| Density | 1.542g/cm3 | Boiling Point | 455.5ºC at 760mmHg | |
| Molecular Formula | C8H7N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4ºC | |
| Name | [2-nitro-1-(2-nitrophenyl)ethyl] nitrate |
|---|
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760mmHg |
| Molecular Formula | C8H7N3O7 |
| Molecular Weight | 257.15700 |
| Flash Point | 226.4ºC |
| Exact Mass | 257.02800 |
| PSA | 146.69000 |
| LogP | 2.69050 |
| Index of Refraction | 1.588 |
| InChIKey | JFCCUOZCLVHJGY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(O[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
|
~%
Benzenemethanol... CAS#:5816-93-3 |
| Literature: Fieser; Daudt Journal of the American Chemical Society, 1946 , vol. 68, p. 2248 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |