methyl 3-(3,4-dimethoxyphenyl)-2-formamido-propanoate structure
|
Common Name | methyl 3-(3,4-dimethoxyphenyl)-2-formamido-propanoate | ||
|---|---|---|---|---|
| CAS Number | 58143-18-3 | Molecular Weight | 267.27800 | |
| Density | 1.163g/cm3 | Boiling Point | 461.2ºC at 760mmHg | |
| Molecular Formula | C13H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | methyl 3-(3,4-dimethoxyphenyl)-2-formamidopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 461.2ºC at 760mmHg |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.27800 |
| Flash Point | 232.8ºC |
| Exact Mass | 267.11100 |
| PSA | 73.86000 |
| LogP | 1.56070 |
| InChIKey | RXCRRUHFHNZMBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccc(OC)c(OC)c1)NC=O |
| HS Code | 2924299090 |
|---|
|
~%
methyl 3-(3,4-d... CAS#:58143-18-3 |
| Literature: Gensler; Bluhm Journal of Organic Chemistry, 1956 , vol. 21, p. 336,338 |
|
~%
methyl 3-(3,4-d... CAS#:58143-18-3 |
| Literature: Gensler; Bluhm Journal of Organic Chemistry, 1956 , vol. 21, p. 336,338 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Formyl-3,4-dimethoxy-phenylalanin-methylester |
| methyl n-formyl-3-methoxy-o-methyltyrosinate |
| N-formyl-3,4-dimethoxy-phenylalanine methyl ester |