8-Formyl-1-naphthoic acid
8-Formyl-1-naphthoic acid structure
|
Common Name | 8-Formyl-1-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 5811-87-0 | Molecular Weight | 200.190 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 441.2±18.0 °C at 760 mmHg | |
| Molecular Formula | C12H8O3 | Melting Point | 160-167ºC | |
| MSDS | Chinese USA | Flash Point | 234.8±17.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,8-Naphthalaldehydic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.2±18.0 °C at 760 mmHg |
| Melting Point | 160-167ºC |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.190 |
| Flash Point | 234.8±17.7 °C |
| Exact Mass | 200.047348 |
| PSA | 54.37000 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | HLHDIWAOQIRETC-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc2cccc(C(=O)O)c12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
|
~70%
8-Formyl-1-naph... CAS#:5811-87-0 |
| Literature: Brunet; Wuest Canadian Journal of Chemistry, 1996 , vol. 74, # 5 p. 689 - 696 |
|
~%
8-Formyl-1-naph... CAS#:5811-87-0 |
| Literature: Helvetica Chimica Acta, , vol. 2, p. 202 |
|
~%
8-Formyl-1-naph... CAS#:5811-87-0 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 276, p. 15 |
|
~%
8-Formyl-1-naph... CAS#:5811-87-0 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 64, # 10 p. 1601 - 1606 |
|
~%
8-Formyl-1-naph... CAS#:5811-87-0
Detail
|
| Literature: DE428088 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 15, p. 394 |
![1H,3H-Naphtho[1,8-cd]pyran-1-one,3-hydroxy- structure](https://image.chemsrc.com/caspic/151/5656-90-6.png)
|
A versatile synthesis of bicyclic lactams from 1, 8-naphthalaldehydic acid: an extension of Meyers' method. Claudio-Catalán MA, et al.
ARKIVOC 4 , 413-23, (2013)
|
| 1-Naphthalenecarboxylic acid, 8-formyl- |
| 8-formylnaphthalene-1-carboxylic acid |
| MFCD00134159 |
| EINECS 227-377-6 |
| 8-Formyl-1-naphthoic acid |