1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylthiocarbamoylamino)phenyl]thiourea
Modify Date: 2025-08-25 23:05:09
![1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylthiocarbamoylamino)phenyl]thiourea Structure](https://image.chemsrc.com/caspic/400/58100-68-8.png)
1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylthiocarbamoylamino)phenyl]thiourea structure
|
Common Name | 1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylthiocarbamoylamino)phenyl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 58100-68-8 | Molecular Weight | 498.49400 | |
| Density | 1.377g/cm3 | Boiling Point | 536.9ºC at 760 mmHg | |
| Molecular Formula | C16H28N4O6P2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.5ºC | |
| Name | 1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylcarbamothioylamino)phenyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 536.9ºC at 760 mmHg |
| Molecular Formula | C16H28N4O6P2S2 |
| Molecular Weight | 498.49400 |
| Flash Point | 278.5ºC |
| Exact Mass | 498.09300 |
| PSA | 202.98000 |
| LogP | 5.54940 |
| Index of Refraction | 1.607 |
| InChIKey | HSKXZZHDZZJKBY-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(NC(=S)Nc1ccccc1NC(=S)NP(=O)(OCC)OCC)OCC |
|
~%
1-diethoxyphosp... CAS#:58100-68-8 |
| Literature: Kulka Canadian Journal of Chemistry, 1959 , vol. 37, p. 525,526 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N',N'''-Bis-diaethoxyphosphoryl-N,N''-o-phenylen-bis-thioharnstoff |
| N',N'''-bis-diethoxyphosphoryl-N,N''-o-phenylene-bis-thiourea |
| o-Phenylen-di(thiocarbamoyl)diphosphorsaeureamid-tetraethylester |
| 1-diethoxyphosphoryl-3-[2-(diethoxyphosphorylthiocarbamoylamino)phenyl]thiourea |