Nonanedioic acid, bis (1-methylpropyl) ester
Modify Date: 2025-08-27 17:11:11
Nonanedioic acid, bis (1-methylpropyl) ester structure
|
Common Name | Nonanedioic acid, bis (1-methylpropyl) ester | ||
|---|---|---|---|---|
| CAS Number | 57983-36-5 | Molecular Weight | 300.43400 | |
| Density | 0.948g/cm3 | Boiling Point | 321.3ºC at 760 mmHg | |
| Molecular Formula | C17H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.9ºC | |
| Name | dibutan-2-yl nonanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.948g/cm3 |
|---|---|
| Boiling Point | 321.3ºC at 760 mmHg |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.43400 |
| Flash Point | 140.9ºC |
| Exact Mass | 300.23000 |
| PSA | 52.60000 |
| LogP | 4.40050 |
| Index of Refraction | 1.444 |
| InChIKey | NWUGLCZYPSNPCE-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)CCCCCCCC(=O)OC(C)CC |
|
~%
Nonanedioic aci... CAS#:57983-36-5 |
| Literature: Cason; McLeod Journal of Organic Chemistry, 1958 , vol. 23, p. 1497,1499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Di(sec-butyl) azelaate |
| nonanedioic acid di-sec-butyl ester |
| Nonanedioic acid,bis(1-methylpropyl) ester |
| Nonandisaeure-di-sec-butylester |