6-(phenylsulfanylmethyl)pteridine-2,4-diamine structure
|
Common Name | 6-(phenylsulfanylmethyl)pteridine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 57963-58-3 | Molecular Weight | 284.34000 | |
| Density | 1.47g/cm3 | Boiling Point | 577.2ºC at 760 mmHg | |
| Molecular Formula | C13H12N6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.9ºC | |
| Name | 6-(phenylsulfanylmethyl)pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 577.2ºC at 760 mmHg |
| Molecular Formula | C13H12N6S |
| Molecular Weight | 284.34000 |
| Flash Point | 302.9ºC |
| Exact Mass | 284.08400 |
| PSA | 128.90000 |
| LogP | 3.03890 |
| Index of Refraction | 1.771 |
| InChIKey | ZJOATKLQTCGUSP-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(CSc3ccccc3)cnc2n1 |
|
~%
6-(phenylsulfan... CAS#:57963-58-3 |
| Literature: Piper, James R.; Johnson, Cheryl A.; Krauth, Charles A.; Carter, Ronald L.; Hosmer, Carla A.; Queener, Sherry F.; Borotz, Susan E.; Pfefferkorn, Elmer R. Journal of Medicinal Chemistry, 1996 , vol. 39, # 6 p. 1271 - 1280 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-phenylsulfanylmethyl-pteridine-2,4-diamine |
| 2,4-Diamino-6-phenylthiomethyl-pteridine |