2,4-Pteridinediamine, 6-(phenoxymethyl)- structure
|
Common Name | 2,4-Pteridinediamine, 6-(phenoxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 57963-57-2 | Molecular Weight | 268.27400 | |
| Density | 1.444g/cm3 | Boiling Point | 557ºC at 760 mmHg | |
| Molecular Formula | C13H12N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.7ºC | |
| Name | 6-(phenoxymethyl)pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 557ºC at 760 mmHg |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.27400 |
| Flash Point | 290.7ºC |
| Exact Mass | 268.10700 |
| PSA | 112.83000 |
| LogP | 2.32560 |
| Index of Refraction | 1.755 |
| InChIKey | AAVNOHSYACQWOK-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(COc3ccccc3)cnc2n1 |
| HS Code | 2933990090 |
|---|
|
~67%
2,4-Pteridinedi... CAS#:57963-57-2 |
| Literature: The United States of America as represented by the Department of Health, Education and Welfare Patent: US4077957 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-phenoxymethyl-pteridine-2,4-diamine |